C29H30BN2OSi — CID 59957115
CID 59957115 (PubChem CID 59957115) has the molecular formula C29H30BN2OSi and a molecular weight of 461.47 g/mol.
| Compound Name | CID 59957115 |
|---|---|
| PubChem CID | 59957115 |
| Molecular Formula | C29H30BN2OSi |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | — |
| SMILES | C[B]ON(c1ccc(N=C(c2ccccc2)c2ccccc2)cc1)c1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C29H30BN2OSi/c1-30-33-32(27-19-21-28(22-20-27)34(2,3)4)26-17-15-25(16-18-26)31-29(23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-22H,1-4H3 |
| InChIKey | RXHCATOCVABVSL-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|