C21H39N5O5 — CID 59958598
tert-butyl N-[(2R)-1-[[2-[[(2S)-5-(1-aminoethenylamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxoheptan-2-yl]carbamate (PubChem CID 59958598) has the molecular formula C21H39N5O5 and a molecular weight of 441.57 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[[2-[[(2S)-5-(1-aminoethenylamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxoheptan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[[2-[[(2S)-5-(1-aminoethenylamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxoheptan-2-yl]carbamate |
|---|---|
| PubChem CID | 59958598 |
| Molecular Formula | C21H39N5O5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | tert-butyl N-[(2R)-1-[[2-[[(2S)-5-(1-aminoethenylamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxoheptan-2-yl]carbamate |
| SMILES | C=C(N)NCCC[C@@H](C=O)NC(=O)CNC(=O)[C@@H](CCCCC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H39N5O5/c1-6-7-8-11-17(26-20(30)31-21(3,4)5)19(29)24-13-18(28)25-16(14-27)10-9-12-23-15(2)22/h14,16-17,23H,2,6-13,22H2,1,3-5H3,(H,24,29)(H,25,28)(H,26,30)/t16-,17+/m0/s1 |
| InChIKey | WZGWRJHCYOPNRC-DLBZAZTESA-N |
| XLogP | 1.06 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|