C22H43N5O5 — CID 126625258
tert-butyl N-[5-amino-6-[[4-(2-aminohexanoylamino)-5-oxopentyl]amino]-6-oxohexyl]carbamate (PubChem CID 126625258) has the molecular formula C22H43N5O5 and a molecular weight of 457.62 g/mol. Its IUPAC name is tert-butyl N-[5-amino-6-[[4-(2-aminohexanoylamino)-5-oxopentyl]amino]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[5-amino-6-[[4-(2-aminohexanoylamino)-5-oxopentyl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 126625258 |
| Molecular Formula | C22H43N5O5 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.33 |
| IUPAC Name | tert-butyl N-[5-amino-6-[[4-(2-aminohexanoylamino)-5-oxopentyl]amino]-6-oxohexyl]carbamate |
| SMILES | CCCCC(N)C(=O)NC(C=O)CCCNC(=O)C(N)CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H43N5O5/c1-5-6-11-18(24)20(30)27-16(15-28)10-9-14-25-19(29)17(23)12-7-8-13-26-21(31)32-22(2,3)4/h15-18H,5-14,23-24H2,1-4H3,(H,25,29)(H,26,31)(H,27,30) |
| InChIKey | PEMGCDPSMXCPME-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 165.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|