C7H6NY3-3 — CID 59961974
3,5-dimethyl-4,6-dihydro-2H-pyridine-2,4,6-triide;tris(yttrium) (PubChem CID 59961974) has the molecular formula C7H6NY3-3 and a molecular weight of 370.85 g/mol. Its IUPAC name is 3,5-dimethyl-4,6-dihydro-2H-pyridine-2,4,6-triide;tris(yttrium).
| Compound Name | 3,5-dimethyl-4,6-dihydro-2H-pyridine-2,4,6-triide;tris(yttrium) |
|---|---|
| PubChem CID | 59961974 |
| Molecular Formula | C7H6NY3-3 |
| Molecular Weight | 370.85 g/mol |
| Exact Mass | 370.77 |
| IUPAC Name | 3,5-dimethyl-4,6-dihydro-2H-pyridine-2,4,6-triide;tris(yttrium) |
| SMILES | Cc1[c-]n[c-]c(C)[c-]1.[Y].[Y].[Y] |
| InChI | InChI=1S/C7H6N.3Y/c1-6-3-7(2)5-8-4-6;;;/h1-2H3;;;/q-3;;; |
| InChIKey | RJJIQBGXHCAWRW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.85 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|