C25H30N2O7 — CID 59963737
cis-methyl (1R,2R)-2-ethenyl-1-[[(1S)-3-[7-methoxy-2-(methylperoxymethyl)quinolin-4-yl]oxycyclopentanecarbonyl]amino]cyclopropane-1-carboxylate (PubChem CID 59963737) has the molecular formula C25H30N2O7 and a molecular weight of 470.52 g/mol. Its IUPAC name is cis-methyl (1R,2R)-2-ethenyl-1-[[(1S)-3-[7-methoxy-2-(methylperoxymethyl)quinolin-4-yl]oxycyclopentanecarbonyl]amino]cyclopropane-1-carboxylate.
| Compound Name | cis-methyl (1R,2R)-2-ethenyl-1-[[(1S)-3-[7-methoxy-2-(methylperoxymethyl)quinolin-4-yl]oxycyclopentanecarbonyl]amino]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 59963737 |
| Molecular Formula | C25H30N2O7 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | cis-methyl (1R,2R)-2-ethenyl-1-[[(1S)-3-[7-methoxy-2-(methylperoxymethyl)quinolin-4-yl]oxycyclopentanecarbonyl]amino]cyclopropane-1-carboxylate |
| SMILES | C=C[C@H]1C[C@]1(NC(=O)[C@H]1CCC(Oc2cc(COOC)nc3cc(OC)ccc23)C1)C(=O)OC |
| InChI | InChI=1S/C25H30N2O7/c1-5-16-13-25(16,24(29)31-3)27-23(28)15-6-7-19(10-15)34-22-11-17(14-33-32-4)26-21-12-18(30-2)8-9-20(21)22/h5,8-9,11-12,15-16,19H,1,6-7,10,13-14H2,2-4H3,(H,27,28)/t15-,16-,19?,25+/m0/s1 |
| InChIKey | BIIKZZQFOBVFTA-MKBGKLEOSA-N |
| XLogP | 3.10 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|