C25H28N4O6 — CID 91022448
cis-methyl (1R,2R)-2-ethenyl-1-[[(1S)-3-[2-[(2Z)-2-hydrazinylideneacetyl]-7-methoxyquinolin-4-yl]oxycyclopentanecarbonyl]amino]cyclopropane-1-carboxylate (PubChem CID 91022448) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is cis-methyl (1R,2R)-2-ethenyl-1-[[(1S)-3-[2-[(2Z)-2-hydrazinylideneacetyl]-7-methoxyquinolin-4-yl]oxycyclopentanecarbonyl]amino]cyclopropane-1-carboxylate.
| Compound Name | cis-methyl (1R,2R)-2-ethenyl-1-[[(1S)-3-[2-[(2Z)-2-hydrazinylideneacetyl]-7-methoxyquinolin-4-yl]oxycyclopentanecarbonyl]amino]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 91022448 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | cis-methyl (1R,2R)-2-ethenyl-1-[[(1S)-3-[2-[(2Z)-2-hydrazinylideneacetyl]-7-methoxyquinolin-4-yl]oxycyclopentanecarbonyl]amino]cyclopropane-1-carboxylate |
| SMILES | C=C[C@H]1C[C@]1(NC(=O)[C@H]1CCC(Oc2cc(C(=O)/C=N\N)nc3cc(OC)ccc23)C1)C(=O)OC |
| InChI | InChI=1S/C25H28N4O6/c1-4-15-12-25(15,24(32)34-3)29-23(31)14-5-6-17(9-14)35-22-11-20(21(30)13-27-26)28-19-10-16(33-2)7-8-18(19)22/h4,7-8,10-11,13-15,17H,1,5-6,9,12,26H2,2-3H3,(H,29,31)/b27-13-/t14-,15-,17?,25+/m0/s1 |
| InChIKey | ISACQKGLDLIBCW-BKKALACGSA-N |
| XLogP | 2.15 |
| TPSA | 142.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|