C13H15FO2 — CID 59963933
(3S)-3-(4-fluorophenyl)-5,5-dimethyloxolane-2-carbaldehyde (PubChem CID 59963933) has the molecular formula C13H15FO2 and a molecular weight of 222.26 g/mol. Its IUPAC name is (3S)-3-(4-fluorophenyl)-5,5-dimethyloxolane-2-carbaldehyde.
| Compound Name | (3S)-3-(4-fluorophenyl)-5,5-dimethyloxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 59963933 |
| Molecular Formula | C13H15FO2 |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (3S)-3-(4-fluorophenyl)-5,5-dimethyloxolane-2-carbaldehyde |
| SMILES | CC1(C)C[C@@H](c2ccc(F)cc2)C(C=O)O1 |
| InChI | InChI=1S/C13H15FO2/c1-13(2)7-11(12(8-15)16-13)9-3-5-10(14)6-4-9/h3-6,8,11-12H,7H2,1-2H3/t11-,12?/m0/s1 |
| InChIKey | YNZJZJYCKDHOFF-PXYINDEMSA-N |
| XLogP | 2.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|