C13H17FO4 — CID 87392982
3-(4-fluorophenyl)-2,4,4-trimethoxybutanal (PubChem CID 87392982) has the molecular formula C13H17FO4 and a molecular weight of 256.27 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2,4,4-trimethoxybutanal.
| Compound Name | 3-(4-fluorophenyl)-2,4,4-trimethoxybutanal |
|---|---|
| PubChem CID | 87392982 |
| Molecular Formula | C13H17FO4 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3-(4-fluorophenyl)-2,4,4-trimethoxybutanal |
| SMILES | COC(C=O)C(c1ccc(F)cc1)C(OC)OC |
| InChI | InChI=1S/C13H17FO4/c1-16-11(8-15)12(13(17-2)18-3)9-4-6-10(14)7-5-9/h4-8,11-13H,1-3H3 |
| InChIKey | MSDUNKAAEJYLIC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|