C18H26N5O3+ — CID 59964740
(S)-amino-methyl-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl]-[2-oxo-2-(4-propan-2-ylanilino)ethyl]azanium (PubChem CID 59964740) has the molecular formula C18H26N5O3+ and a molecular weight of 360.44 g/mol. Its IUPAC name is (S)-amino-methyl-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl]-[2-oxo-2-(4-propan-2-ylanilino)ethyl]azanium.
| Compound Name | (S)-amino-methyl-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl]-[2-oxo-2-(4-propan-2-ylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 59964740 |
| Molecular Formula | C18H26N5O3+ |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (S)-amino-methyl-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl]-[2-oxo-2-(4-propan-2-ylanilino)ethyl]azanium |
| SMILES | CC(C)c1ccc(NC(=O)C[N@@+](C)(N)Cc2c[nH]c(=O)n(C)c2=O)cc1 |
| InChI | InChI=1S/C18H25N5O3/c1-12(2)13-5-7-15(8-6-13)21-16(24)11-23(4,19)10-14-9-20-18(26)22(3)17(14)25/h5-9,12H,10-11,19H2,1-4H3,(H-,20,21,24,25,26)/p+1/t23-/m0/s1 |
| InChIKey | AEXWFBGOUFXAQI-QHCPKHFHSA-O |
| XLogP | 0.66 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|