C20H27ClN5O4+ — CID 59964753
(S)-[(2-chloroacetyl)amino]-methyl-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl]-[2-oxo-2-(4-propan-2-ylanilino)ethyl]azanium (PubChem CID 59964753) has the molecular formula C20H27ClN5O4+ and a molecular weight of 436.92 g/mol. Its IUPAC name is (S)-[(2-chloroacetyl)amino]-methyl-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl]-[2-oxo-2-(4-propan-2-ylanilino)ethyl]azanium.
| Compound Name | (S)-[(2-chloroacetyl)amino]-methyl-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl]-[2-oxo-2-(4-propan-2-ylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 59964753 |
| Molecular Formula | C20H27ClN5O4+ |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (S)-[(2-chloroacetyl)amino]-methyl-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl]-[2-oxo-2-(4-propan-2-ylanilino)ethyl]azanium |
| SMILES | CC(C)c1ccc(NC(=O)C[N@+](C)(Cc2c[nH]c(=O)n(C)c2=O)NC(=O)CCl)cc1 |
| InChI | InChI=1S/C20H26ClN5O4/c1-13(2)14-5-7-16(8-6-14)23-18(28)12-26(4,24-17(27)9-21)11-15-10-22-20(30)25(3)19(15)29/h5-8,10,13H,9,11-12H2,1-4H3,(H2-,22,23,24,27,28,29,30)/p+1/t26-/m0/s1 |
| InChIKey | BXTHYHRVDGIUPG-SANMLTNESA-O |
| XLogP | 1.05 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|