C10H20O7S — CID 59969160
4-(2-hydroxy-3-prop-2-enoxypropyl)peroxybutane-2-sulfonic acid (PubChem CID 59969160) has the molecular formula C10H20O7S and a molecular weight of 284.33 g/mol. Its IUPAC name is 4-(2-hydroxy-3-prop-2-enoxypropyl)peroxybutane-2-sulfonic acid.
| Compound Name | 4-(2-hydroxy-3-prop-2-enoxypropyl)peroxybutane-2-sulfonic acid |
|---|---|
| PubChem CID | 59969160 |
| Molecular Formula | C10H20O7S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 4-(2-hydroxy-3-prop-2-enoxypropyl)peroxybutane-2-sulfonic acid |
| SMILES | C=CCOCC(O)COOCCC(C)S(=O)(=O)O |
| InChI | InChI=1S/C10H20O7S/c1-3-5-15-7-10(11)8-17-16-6-4-9(2)18(12,13)14/h3,9-11H,1,4-8H2,2H3,(H,12,13,14) |
| InChIKey | FGRCCSQUAXMXFL-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|