C10H19NaO7S — CID 59969154
sodium 1-(2-hydroxy-3-prop-2-enoxypropyl)peroxybutane-2-sulfonate (PubChem CID 59969154) has the molecular formula C10H19NaO7S and a molecular weight of 306.31 g/mol. Its IUPAC name is sodium 1-(2-hydroxy-3-prop-2-enoxypropyl)peroxybutane-2-sulfonate.
| Compound Name | sodium 1-(2-hydroxy-3-prop-2-enoxypropyl)peroxybutane-2-sulfonate |
|---|---|
| PubChem CID | 59969154 |
| Molecular Formula | C10H19NaO7S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | sodium 1-(2-hydroxy-3-prop-2-enoxypropyl)peroxybutane-2-sulfonate |
| SMILES | C=CCOCC(O)COOCC(CC)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H20O7S.Na/c1-3-5-15-6-9(11)7-16-17-8-10(4-2)18(12,13)14;/h3,9-11H,1,4-8H2,2H3,(H,12,13,14);/q;+1/p-1 |
| InChIKey | NVMOZWQOOIRRGO-UHFFFAOYSA-M |
| XLogP | -3.17 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|