C14H26KNO7S — CID 140600230
potassium 2-[bis(2-hydroxy-3-prop-2-enoxypropyl)amino]ethanesulfonate (PubChem CID 140600230) has the molecular formula C14H26KNO7S and a molecular weight of 391.53 g/mol. Its IUPAC name is potassium 2-[bis(2-hydroxy-3-prop-2-enoxypropyl)amino]ethanesulfonate.
| Compound Name | potassium 2-[bis(2-hydroxy-3-prop-2-enoxypropyl)amino]ethanesulfonate |
|---|---|
| PubChem CID | 140600230 |
| Molecular Formula | C14H26KNO7S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | potassium 2-[bis(2-hydroxy-3-prop-2-enoxypropyl)amino]ethanesulfonate |
| SMILES | C=CCOCC(O)CN(CCS(=O)(=O)[O-])CC(O)COCC=C.[K+] |
| InChI | InChI=1S/C14H27NO7S.K/c1-3-6-21-11-13(16)9-15(5-8-23(18,19)20)10-14(17)12-22-7-4-2;/h3-4,13-14,16-17H,1-2,5-12H2,(H,18,19,20);/q;+1/p-1 |
| InChIKey | QOZPCYYMOFLNKQ-UHFFFAOYSA-M |
| XLogP | -4.04 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | -4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|