C15H22F3NOS2 — CID 59971173
(E)-2-methyl-1-(3-methylsulfanylpiperidin-1-yl)-3-[5-(trifluoromethyl)thiolan-2-yl]prop-2-en-1-one (PubChem CID 59971173) has the molecular formula C15H22F3NOS2 and a molecular weight of 353.48 g/mol. Its IUPAC name is (E)-2-methyl-1-(3-methylsulfanylpiperidin-1-yl)-3-[5-(trifluoromethyl)thiolan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-2-methyl-1-(3-methylsulfanylpiperidin-1-yl)-3-[5-(trifluoromethyl)thiolan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 59971173 |
| Molecular Formula | C15H22F3NOS2 |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | (E)-2-methyl-1-(3-methylsulfanylpiperidin-1-yl)-3-[5-(trifluoromethyl)thiolan-2-yl]prop-2-en-1-one |
| SMILES | CSC1CCCN(C(=O)/C(C)=C/C2CCC(C(F)(F)F)S2)C1 |
| InChI | InChI=1S/C15H22F3NOS2/c1-10(8-11-5-6-13(22-11)15(16,17)18)14(20)19-7-3-4-12(9-19)21-2/h8,11-13H,3-7,9H2,1-2H3/b10-8+ |
| InChIKey | KPYDUWBJKUCMQS-CSKARUKUSA-N |
| XLogP | 4.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|