C16H14FNO4 — CID 59971218
(Z)-4-[1-[2-(4-fluorophenyl)ethyl]pyrrol-2-yl]-4-hydroxy-2-oxobut-3-enoic acid (PubChem CID 59971218) has the molecular formula C16H14FNO4 and a molecular weight of 303.29 g/mol. Its IUPAC name is (Z)-4-[1-[2-(4-fluorophenyl)ethyl]pyrrol-2-yl]-4-hydroxy-2-oxobut-3-enoic acid.
| Compound Name | (Z)-4-[1-[2-(4-fluorophenyl)ethyl]pyrrol-2-yl]-4-hydroxy-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 59971218 |
| Molecular Formula | C16H14FNO4 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | (Z)-4-[1-[2-(4-fluorophenyl)ethyl]pyrrol-2-yl]-4-hydroxy-2-oxobut-3-enoic acid |
| SMILES | O=C(O)C(=O)/C=C(\O)c1cccn1CCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H14FNO4/c17-12-5-3-11(4-6-12)7-9-18-8-1-2-13(18)14(19)10-15(20)16(21)22/h1-6,8,10,19H,7,9H2,(H,21,22)/b14-10- |
| InChIKey | WQCFZFCTBOUKDX-UVTDQMKNSA-N |
| XLogP | 2.42 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|