C9H8NOY- — CID 59971443
5-methyl-3,4-dihydro-1H-indol-4-id-2-one;yttrium (PubChem CID 59971443) has the molecular formula C9H8NOY- and a molecular weight of 235.07 g/mol. Its IUPAC name is 5-methyl-3,4-dihydro-1H-indol-4-id-2-one;yttrium.
| Compound Name | 5-methyl-3,4-dihydro-1H-indol-4-id-2-one;yttrium |
|---|---|
| PubChem CID | 59971443 |
| Molecular Formula | C9H8NOY- |
| Molecular Weight | 235.07 g/mol |
| Exact Mass | 234.97 |
| IUPAC Name | 5-methyl-3,4-dihydro-1H-indol-4-id-2-one;yttrium |
| SMILES | Cc1[c-]c2c(cc1)NC(=O)C2.[Y] |
| InChI | InChI=1S/C9H8NO.Y/c1-6-2-3-8-7(4-6)5-9(11)10-8;/h2-3H,5H2,1H3,(H,10,11);/q-1; |
| InChIKey | GTPPGSONWCDYOE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.07 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|