About carbanide;cyclopentyl(methyl)tin;samarium
carbanide;cyclopentyl(methyl)tin;samarium (PubChem CID 59973958) has the molecular formula C7H14SmSn-2
and a molecular weight of 367.26 g/mol. Its IUPAC name is carbanide;cyclopentyl(methyl)tin;samarium.
Molecular Properties
| Compound Name | carbanide;cyclopentyl(methyl)tin;samarium |
| PubChem CID | 59973958 |
| Molecular Formula | C7H14SmSn-2 |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 369.93 |
| IUPAC Name | carbanide;cyclopentyl(methyl)tin;samarium |
| SMILES | C[Sn]C1[CH-]CCC1.[CH3-].[Sm] |
| InChI | InChI=1S/C5H8.2CH3.Sm.Sn/c1-2-4-5-3-1;;;;/h1-2H,3-5H2;2*1H3;;/q-1;;-1;; |
| InChIKey | YJLIRWQYQDTMHZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;cyclopentyl(methyl)tin;samarium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;cyclopentyl(methyl)tin;samarium?
The IUPAC name of carbanide;cyclopentyl(methyl)tin;samarium (CID 59973958) is carbanide;cyclopentyl(methyl)tin;samarium.
What is the SMILES notation for carbanide;cyclopentyl(methyl)tin;samarium?
The canonical SMILES for carbanide;cyclopentyl(methyl)tin;samarium is C[Sn]C1[CH-]CCC1.[CH3-].[Sm].
What is the InChIKey of carbanide;cyclopentyl(methyl)tin;samarium?
The InChIKey is YJLIRWQYQDTMHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8.2CH3.Sm.Sn/c1-2-4-5-3-1;;;;/h1-2H,3-5H2;2*1H3;;/q-1;;-1;;.
What are the key properties of carbanide;cyclopentyl(methyl)tin;samarium?
carbanide;cyclopentyl(methyl)tin;samarium has a molecular weight of 367.26 g/mol, XLogP of 2.37, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;cyclopentyl(methyl)tin;samarium is sourced from PubChem (CID 59973958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).