C11H20Y-2 — CID 58700071
3,3-dimethylbutan-2-ylcyclopentane;yttrium (PubChem CID 58700071) has the molecular formula C11H20Y-2 and a molecular weight of 241.19 g/mol. Its IUPAC name is 3,3-dimethylbutan-2-ylcyclopentane;yttrium.
| Compound Name | 3,3-dimethylbutan-2-ylcyclopentane;yttrium |
|---|---|
| PubChem CID | 58700071 |
| Molecular Formula | C11H20Y-2 |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 3,3-dimethylbutan-2-ylcyclopentane;yttrium |
| SMILES | [CH2-]C(C1[CH-]CCC1)C(C)(C)C.[Y] |
| InChI | InChI=1S/C11H20.Y/c1-9(11(2,3)4)10-7-5-6-8-10;/h7,9-10H,1,5-6,8H2,2-4H3;/q-2; |
| InChIKey | KHUKSCPHGLCKMK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|