C10H16W — CID 58884623
1-methanidyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-7-ide;tungsten(2+) (PubChem CID 58884623) has the molecular formula C10H16W and a molecular weight of 320.08 g/mol. Its IUPAC name is 1-methanidyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-7-ide;tungsten(2+).
| Compound Name | 1-methanidyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-7-ide;tungsten(2+) |
|---|---|
| PubChem CID | 58884623 |
| Molecular Formula | C10H16W |
| Molecular Weight | 320.08 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 1-methanidyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-7-ide;tungsten(2+) |
| SMILES | [CH2-]C1CCC2CCC[CH-]C12.[W+2] |
| InChI | InChI=1S/C10H16.W/c1-8-6-7-9-4-2-3-5-10(8)9;/h5,8-10H,1-4,6-7H2;/q-2;+2 |
| InChIKey | QMNFVEASDLXUPD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.08 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|