About propylcyclohexane;yttrium
propylcyclohexane;yttrium (PubChem CID 58734002) has the molecular formula C9H16Y-2
and a molecular weight of 213.13 g/mol. Its IUPAC name is propylcyclohexane;yttrium.
Molecular Properties
| Compound Name | propylcyclohexane;yttrium |
| PubChem CID | 58734002 |
| Molecular Formula | C9H16Y-2 |
| Molecular Weight | 213.13 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | propylcyclohexane;yttrium |
| SMILES | [CH2-]CCC1[CH-]CCCC1.[Y] |
| InChI | InChI=1S/C9H16.Y/c1-2-6-9-7-4-3-5-8-9;/h7,9H,1-6,8H2;/q-2; |
| InChIKey | KBDKGBCHJLSZGP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.13 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze propylcyclohexane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propylcyclohexane;yttrium?
The IUPAC name of propylcyclohexane;yttrium (CID 58734002) is propylcyclohexane;yttrium.
What is the SMILES notation for propylcyclohexane;yttrium?
The canonical SMILES for propylcyclohexane;yttrium is [CH2-]CCC1[CH-]CCCC1.[Y].
What is the InChIKey of propylcyclohexane;yttrium?
The InChIKey is KBDKGBCHJLSZGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16.Y/c1-2-6-9-7-4-3-5-8-9;/h7,9H,1-6,8H2;/q-2;.
What are the key properties of propylcyclohexane;yttrium?
propylcyclohexane;yttrium has a molecular weight of 213.13 g/mol, XLogP of 2.99, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for propylcyclohexane;yttrium is sourced from PubChem (CID 58734002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).