About N-cyclohexylethanimine;yttrium
N-cyclohexylethanimine;yttrium (PubChem CID 58247545) has the molecular formula C8H13NY-2
and a molecular weight of 212.10 g/mol. Its IUPAC name is N-cyclohexylethanimine;yttrium.
Molecular Properties
| Compound Name | N-cyclohexylethanimine;yttrium |
| PubChem CID | 58247545 |
| Molecular Formula | C8H13NY-2 |
| Molecular Weight | 212.10 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | N-cyclohexylethanimine;yttrium |
| SMILES | [CH2-]/C=N\C1[CH-]CCCC1.[Y] |
| InChI | InChI=1S/C8H13N.Y/c1-2-9-8-6-4-3-5-7-8;/h2,6,8H,1,3-5,7H2;/q-2;/b9-2-; |
| InChIKey | DCACHTYGJYJXMG-LABXZRATSA-N |
| XLogP | 2.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.10 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexylethanimine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexylethanimine;yttrium?
The IUPAC name of N-cyclohexylethanimine;yttrium (CID 58247545) is N-cyclohexylethanimine;yttrium.
What is the SMILES notation for N-cyclohexylethanimine;yttrium?
The canonical SMILES for N-cyclohexylethanimine;yttrium is [CH2-]/C=N\C1[CH-]CCCC1.[Y].
What is the InChIKey of N-cyclohexylethanimine;yttrium?
The InChIKey is DCACHTYGJYJXMG-LABXZRATSA-N. The full InChI is InChI=1S/C8H13N.Y/c1-2-9-8-6-4-3-5-7-8;/h2,6,8H,1,3-5,7H2;/q-2;/b9-2-;.
What are the key properties of N-cyclohexylethanimine;yttrium?
N-cyclohexylethanimine;yttrium has a molecular weight of 212.10 g/mol, XLogP of 2.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylethanimine;yttrium is sourced from PubChem (CID 58247545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).