C18H30Y-2 — CID 59928092
bis(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-3-ide);yttrium (PubChem CID 59928092) has the molecular formula C18H30Y-2 and a molecular weight of 335.34 g/mol. Its IUPAC name is bis(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-3-ide);yttrium.
| Compound Name | bis(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-3-ide);yttrium |
|---|---|
| PubChem CID | 59928092 |
| Molecular Formula | C18H30Y-2 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | bis(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-3-ide);yttrium |
| SMILES | [CH-]1CCC2CCCCC12.[CH-]1CCC2CCCCC12.[Y] |
| InChI | InChI=1S/2C9H15.Y/c2*1-2-5-9-7-3-6-8(9)4-1;/h2*6,8-9H,1-5,7H2;/q2*-1; |
| InChIKey | CYEFUJPJBRLTKP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|