C21H31ClO — CID 59976971
(3S,5S,10R,13S)-5-chloro-17-ethenylidene-10,13-dimethyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 59976971) has the molecular formula C21H31ClO and a molecular weight of 334.93 g/mol. Its IUPAC name is (3S,5S,10R,13S)-5-chloro-17-ethenylidene-10,13-dimethyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5S,10R,13S)-5-chloro-17-ethenylidene-10,13-dimethyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 59976971 |
| Molecular Formula | C21H31ClO |
| Molecular Weight | 334.93 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (3S,5S,10R,13S)-5-chloro-17-ethenylidene-10,13-dimethyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C=C=C1CCC2C3CC[C@]4(Cl)C[C@@H](O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C21H31ClO/c1-4-14-5-6-17-16-8-12-21(22)13-15(23)7-11-20(21,3)18(16)9-10-19(14,17)2/h15-18,23H,1,5-13H2,2-3H3/t15-,16?,17?,18?,19+,20+,21-/m0/s1 |
| InChIKey | MPJFBAYEJBQWPD-OMCODTPKSA-N |
| XLogP | 5.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.93 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|