C29H37N5O6 — CID 59977150
(3R)-3-[[2-[4,4-dimethyl-2,5-dioxo-3-[[4-[(2,3,4,6-tetramethylphenyl)carbamoylamino]phenyl]methyl]imidazolidin-1-yl]acetyl]amino]butanoic acid (PubChem CID 59977150) has the molecular formula C29H37N5O6 and a molecular weight of 551.64 g/mol. Its IUPAC name is (3R)-3-[[2-[4,4-dimethyl-2,5-dioxo-3-[[4-[(2,3,4,6-tetramethylphenyl)carbamoylamino]phenyl]methyl]imidazolidin-1-yl]acetyl]amino]butanoic acid.
| Compound Name | (3R)-3-[[2-[4,4-dimethyl-2,5-dioxo-3-[[4-[(2,3,4,6-tetramethylphenyl)carbamoylamino]phenyl]methyl]imidazolidin-1-yl]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 59977150 |
| Molecular Formula | C29H37N5O6 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | (3R)-3-[[2-[4,4-dimethyl-2,5-dioxo-3-[[4-[(2,3,4,6-tetramethylphenyl)carbamoylamino]phenyl]methyl]imidazolidin-1-yl]acetyl]amino]butanoic acid |
| SMILES | Cc1cc(C)c(NC(=O)Nc2ccc(CN3C(=O)N(CC(=O)N[C@H](C)CC(=O)O)C(=O)C3(C)C)cc2)c(C)c1C |
| InChI | InChI=1S/C29H37N5O6/c1-16-12-17(2)25(20(5)19(16)4)32-27(39)31-22-10-8-21(9-11-22)14-34-28(40)33(26(38)29(34,6)7)15-23(35)30-18(3)13-24(36)37/h8-12,18H,13-15H2,1-7H3,(H,30,35)(H,36,37)(H2,31,32,39)/t18-/m1/s1 |
| InChIKey | UGURZSBUXHVMLL-GOSISDBHSA-N |
| XLogP | 4.09 |
| TPSA | 148.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|