C19H18N2O4S2 — CID 59977660
5-[[4-[2-(2,5-dimethyl-1,3-oxazol-4-yl)ethoxy]-1-benzothiophen-7-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 59977660) has the molecular formula C19H18N2O4S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 5-[[4-[2-(2,5-dimethyl-1,3-oxazol-4-yl)ethoxy]-1-benzothiophen-7-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-(2,5-dimethyl-1,3-oxazol-4-yl)ethoxy]-1-benzothiophen-7-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 59977660 |
| Molecular Formula | C19H18N2O4S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 5-[[4-[2-(2,5-dimethyl-1,3-oxazol-4-yl)ethoxy]-1-benzothiophen-7-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1nc(CCOc2ccc(CC3SC(=O)NC3=O)c3sccc23)c(C)o1 |
| InChI | InChI=1S/C19H18N2O4S2/c1-10-14(20-11(2)25-10)5-7-24-15-4-3-12(17-13(15)6-8-26-17)9-16-18(22)21-19(23)27-16/h3-4,6,8,16H,5,7,9H2,1-2H3,(H,21,22,23) |
| InChIKey | SJYHLOCOWKNPCW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|