C26H25NO3 — CID 59979398
[7-[2-(2,4-dimethylphenyl)ethenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-(4-methoxyphenyl)methanone (PubChem CID 59979398) has the molecular formula C26H25NO3 and a molecular weight of 399.49 g/mol. Its IUPAC name is [7-[2-(2,4-dimethylphenyl)ethenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [7-[2-(2,4-dimethylphenyl)ethenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 59979398 |
| Molecular Formula | C26H25NO3 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | [7-[2-(2,4-dimethylphenyl)ethenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCOc3cc(C=Cc4ccc(C)cc4C)ccc32)cc1 |
| InChI | InChI=1S/C26H25NO3/c1-18-4-7-21(19(2)16-18)8-5-20-6-13-24-25(17-20)30-15-14-27(24)26(28)22-9-11-23(29-3)12-10-22/h4-13,16-17H,14-15H2,1-3H3 |
| InChIKey | FDWRVPCPMCEFJV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|