C17H17N3O4S — CID 59980820
N'-(benzenesulfonyl)-5-(dimethylamino)-1-benzofuran-2-carbohydrazide (PubChem CID 59980820) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-5-(dimethylamino)-1-benzofuran-2-carbohydrazide.
| Compound Name | N'-(benzenesulfonyl)-5-(dimethylamino)-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 59980820 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N'-(benzenesulfonyl)-5-(dimethylamino)-1-benzofuran-2-carbohydrazide |
| SMILES | CN(C)c1ccc2oc(C(=O)NNS(=O)(=O)c3ccccc3)cc2c1 |
| InChI | InChI=1S/C17H17N3O4S/c1-20(2)13-8-9-15-12(10-13)11-16(24-15)17(21)18-19-25(22,23)14-6-4-3-5-7-14/h3-11,19H,1-2H3,(H,18,21) |
| InChIKey | NJCRBQUXVHXXAF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|