C19H10Cl3F3N2O5S — CID 59982439
3-chloro-N-(2,5-dichlorophenyl)-4-[4-nitro-2-(trifluoromethyl)phenoxy]benzenesulfonamide (PubChem CID 59982439) has the molecular formula C19H10Cl3F3N2O5S and a molecular weight of 541.72 g/mol. Its IUPAC name is 3-chloro-N-(2,5-dichlorophenyl)-4-[4-nitro-2-(trifluoromethyl)phenoxy]benzenesulfonamide.
| Compound Name | 3-chloro-N-(2,5-dichlorophenyl)-4-[4-nitro-2-(trifluoromethyl)phenoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 59982439 |
| Molecular Formula | C19H10Cl3F3N2O5S |
| Molecular Weight | 541.72 g/mol |
| Exact Mass | 539.93 |
| IUPAC Name | 3-chloro-N-(2,5-dichlorophenyl)-4-[4-nitro-2-(trifluoromethyl)phenoxy]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(S(=O)(=O)Nc3cc(Cl)ccc3Cl)cc2Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H10Cl3F3N2O5S/c20-10-1-4-14(21)16(7-10)26-33(30,31)12-3-6-18(15(22)9-12)32-17-5-2-11(27(28)29)8-13(17)19(23,24)25/h1-9,26H |
| InChIKey | JNCFKMMASLLTDP-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.72 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|