C27H32BrN3O3S — CID 59983328
2-[4-[4-[(4-bromo-2-methylphenyl)carbamoyl]-5-methyl-1-pentylimidazol-2-yl]phenyl]sulfanyl-2-methylpropanoic acid (PubChem CID 59983328) has the molecular formula C27H32BrN3O3S and a molecular weight of 558.54 g/mol. Its IUPAC name is 2-[4-[4-[(4-bromo-2-methylphenyl)carbamoyl]-5-methyl-1-pentylimidazol-2-yl]phenyl]sulfanyl-2-methylpropanoic acid.
| Compound Name | 2-[4-[4-[(4-bromo-2-methylphenyl)carbamoyl]-5-methyl-1-pentylimidazol-2-yl]phenyl]sulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 59983328 |
| Molecular Formula | C27H32BrN3O3S |
| Molecular Weight | 558.54 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | 2-[4-[4-[(4-bromo-2-methylphenyl)carbamoyl]-5-methyl-1-pentylimidazol-2-yl]phenyl]sulfanyl-2-methylpropanoic acid |
| SMILES | CCCCCn1c(-c2ccc(SC(C)(C)C(=O)O)cc2)nc(C(=O)Nc2ccc(Br)cc2C)c1C |
| InChI | InChI=1S/C27H32BrN3O3S/c1-6-7-8-15-31-18(3)23(25(32)29-22-14-11-20(28)16-17(22)2)30-24(31)19-9-12-21(13-10-19)35-27(4,5)26(33)34/h9-14,16H,6-8,15H2,1-5H3,(H,29,32)(H,33,34) |
| InChIKey | PPBVSTMILRSADU-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.54 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|