C31H31N3O4S2 — CID 59983592
2-methyl-2-[3-methyl-4-[4-[(4-morpholin-4-ylphenyl)carbamoyl]-5-phenyl-1,3-thiazol-2-yl]phenyl]sulfanylpropanoic acid (PubChem CID 59983592) has the molecular formula C31H31N3O4S2 and a molecular weight of 573.74 g/mol. Its IUPAC name is 2-methyl-2-[3-methyl-4-[4-[(4-morpholin-4-ylphenyl)carbamoyl]-5-phenyl-1,3-thiazol-2-yl]phenyl]sulfanylpropanoic acid.
| Compound Name | 2-methyl-2-[3-methyl-4-[4-[(4-morpholin-4-ylphenyl)carbamoyl]-5-phenyl-1,3-thiazol-2-yl]phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 59983592 |
| Molecular Formula | C31H31N3O4S2 |
| Molecular Weight | 573.74 g/mol |
| Exact Mass | 573.18 |
| IUPAC Name | 2-methyl-2-[3-methyl-4-[4-[(4-morpholin-4-ylphenyl)carbamoyl]-5-phenyl-1,3-thiazol-2-yl]phenyl]sulfanylpropanoic acid |
| SMILES | Cc1cc(SC(C)(C)C(=O)O)ccc1-c1nc(C(=O)Nc2ccc(N3CCOCC3)cc2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C31H31N3O4S2/c1-20-19-24(40-31(2,3)30(36)37)13-14-25(20)29-33-26(27(39-29)21-7-5-4-6-8-21)28(35)32-22-9-11-23(12-10-22)34-15-17-38-18-16-34/h4-14,19H,15-18H2,1-3H3,(H,32,35)(H,36,37) |
| InChIKey | JGZXLTNXXPYFFX-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.74 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|