C11H28O6Si2 — CID 59991444
[dimethoxy(methyl)silyl]methyl-(2,2-dimethoxypropyl)-dimethoxysilane (PubChem CID 59991444) has the molecular formula C11H28O6Si2 and a molecular weight of 312.51 g/mol. Its IUPAC name is [dimethoxy(methyl)silyl]methyl-(2,2-dimethoxypropyl)-dimethoxysilane.
| Compound Name | [dimethoxy(methyl)silyl]methyl-(2,2-dimethoxypropyl)-dimethoxysilane |
|---|---|
| PubChem CID | 59991444 |
| Molecular Formula | C11H28O6Si2 |
| Molecular Weight | 312.51 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | [dimethoxy(methyl)silyl]methyl-(2,2-dimethoxypropyl)-dimethoxysilane |
| SMILES | COC(C)(C[Si](C[Si](C)(OC)OC)(OC)OC)OC |
| InChI | InChI=1S/C11H28O6Si2/c1-11(12-2,13-3)9-19(16-6,17-7)10-18(8,14-4)15-5/h9-10H2,1-8H3 |
| InChIKey | BFIWNFCZWXENIK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.51 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|