C11H23Y- — CID 59996520
2,4,5,5-tetramethylheptane;yttrium (PubChem CID 59996520) has the molecular formula C11H23Y- and a molecular weight of 244.21 g/mol. Its IUPAC name is 2,4,5,5-tetramethylheptane;yttrium.
| Compound Name | 2,4,5,5-tetramethylheptane;yttrium |
|---|---|
| PubChem CID | 59996520 |
| Molecular Formula | C11H23Y- |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2,4,5,5-tetramethylheptane;yttrium |
| SMILES | CCC(C)(C)C(C)C[C-](C)C.[Y] |
| InChI | InChI=1S/C11H23.Y/c1-7-11(5,6)10(4)8-9(2)3;/h10H,7-8H2,1-6H3;/q-1; |
| InChIKey | SPEOALHVDABFIM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|