About 2,4,5,5-tetramethylheptane;yttrium
2,4,5,5-tetramethylheptane;yttrium (PubChem CID 59996520) has the molecular formula C11H23Y-
and a molecular weight of 244.21 g/mol. Its IUPAC name is 2,4,5,5-tetramethylheptane;yttrium.
Molecular Properties
| Compound Name | 2,4,5,5-tetramethylheptane;yttrium |
| PubChem CID | 59996520 |
| Molecular Formula | C11H23Y- |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2,4,5,5-tetramethylheptane;yttrium |
| SMILES | CCC(C)(C)C(C)C[C-](C)C.[Y] |
| InChI | InChI=1S/C11H23.Y/c1-7-11(5,6)10(4)8-9(2)3;/h10H,7-8H2,1-6H3;/q-1; |
| InChIKey | SPEOALHVDABFIM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,4,5,5-tetramethylheptane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5,5-tetramethylheptane;yttrium?
The IUPAC name of 2,4,5,5-tetramethylheptane;yttrium (CID 59996520) is 2,4,5,5-tetramethylheptane;yttrium.
What is the SMILES notation for 2,4,5,5-tetramethylheptane;yttrium?
The canonical SMILES for 2,4,5,5-tetramethylheptane;yttrium is CCC(C)(C)C(C)C[C-](C)C.[Y].
What is the InChIKey of 2,4,5,5-tetramethylheptane;yttrium?
The InChIKey is SPEOALHVDABFIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23.Y/c1-7-11(5,6)10(4)8-9(2)3;/h10H,7-8H2,1-6H3;/q-1;.
What are the key properties of 2,4,5,5-tetramethylheptane;yttrium?
2,4,5,5-tetramethylheptane;yttrium has a molecular weight of 244.21 g/mol, XLogP of 4.06, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5,5-tetramethylheptane;yttrium is sourced from PubChem (CID 59996520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).