C9H12NRbRe — CID 59997632
rhenium;rubidium(1+);1,3,4,6-tetramethyl-2,5-dihydropyridin-1-ium-2,5-diide (PubChem CID 59997632) has the molecular formula C9H12NRbRe and a molecular weight of 405.88 g/mol. Its IUPAC name is rhenium;rubidium(1+);1,3,4,6-tetramethyl-2,5-dihydropyridin-1-ium-2,5-diide.
| Compound Name | rhenium;rubidium(1+);1,3,4,6-tetramethyl-2,5-dihydropyridin-1-ium-2,5-diide |
|---|---|
| PubChem CID | 59997632 |
| Molecular Formula | C9H12NRbRe |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.96 |
| IUPAC Name | rhenium;rubidium(1+);1,3,4,6-tetramethyl-2,5-dihydropyridin-1-ium-2,5-diide |
| SMILES | Cc1[c-]c(C)[n+](C)[c-]c1C.[Rb+].[Re] |
| InChI | InChI=1S/C9H12N.Rb.Re/c1-7-5-9(3)10(4)6-8(7)2;;/h1-4H3;;/q-1;+1; |
| InChIKey | TZMFGOVWKQENKY-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|