C11H14NRbRe — CID 59339957
6-ethenyl-1-ethyl-3,4-dimethyl-2,5-dihydropyridin-1-ium-2,5-diide;rhenium;rubidium(1+) (PubChem CID 59339957) has the molecular formula C11H14NRbRe and a molecular weight of 431.92 g/mol. Its IUPAC name is 6-ethenyl-1-ethyl-3,4-dimethyl-2,5-dihydropyridin-1-ium-2,5-diide;rhenium;rubidium(1+).
| Compound Name | 6-ethenyl-1-ethyl-3,4-dimethyl-2,5-dihydropyridin-1-ium-2,5-diide;rhenium;rubidium(1+) |
|---|---|
| PubChem CID | 59339957 |
| Molecular Formula | C11H14NRbRe |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.98 |
| IUPAC Name | 6-ethenyl-1-ethyl-3,4-dimethyl-2,5-dihydropyridin-1-ium-2,5-diide;rhenium;rubidium(1+) |
| SMILES | C=Cc1[c-]c(C)c(C)[c-][n+]1CC.[Rb+].[Re] |
| InChI | InChI=1S/C11H14N.Rb.Re/c1-5-11-7-9(3)10(4)8-12(11)6-2;;/h5H,1,6H2,2-4H3;;/q-1;+1; |
| InChIKey | QGTZKHTWNNXIKA-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|