C9H9Cl2NO2 — CID 600035
3-amino-3-(2,4-dichlorophenyl)propanoic acid (PubChem CID 600035) has the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. Its IUPAC name is 3-amino-3-(2,4-dichlorophenyl)propanoic acid.
| Compound Name | 3-amino-3-(2,4-dichlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 600035 |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.08 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | 3-amino-3-(2,4-dichlorophenyl)propanoic acid |
| SMILES | NC(CC(=O)O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl2NO2/c10-5-1-2-6(7(11)3-5)8(12)4-9(13)14/h1-3,8H,4,12H2,(H,13,14) |
| InChIKey | QGHQDRDWQIHGKZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.08 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |