C12H12N2O2 — CID 6001760
N-[(E)-6-bicyclo[3.2.0]hept-2-enylideneamino]furan-2-carboxamide (PubChem CID 6001760) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is N-[(E)-6-bicyclo[3.2.0]hept-2-enylideneamino]furan-2-carboxamide.
| Compound Name | N-[(E)-6-bicyclo[3.2.0]hept-2-enylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 6001760 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | N-[(E)-6-bicyclo[3.2.0]hept-2-enylideneamino]furan-2-carboxamide |
| SMILES | O=C(N/N=C1\CC2C=CCC12)c1ccco1 |
| InChI | InChI=1S/C12H12N2O2/c15-12(11-5-2-6-16-11)14-13-10-7-8-3-1-4-9(8)10/h1-3,5-6,8-9H,4,7H2,(H,14,15)/b13-10+ |
| InChIKey | YKSLVXUPCZDIFI-JLHYYAGUSA-N |
| XLogP | 1.96 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|