C9H10N2O2 — CID 601343
4-hydroxy-5-methyl-3-phenyl-5H-1,2,4-oxadiazole (PubChem CID 601343) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-hydroxy-5-methyl-3-phenyl-5H-1,2,4-oxadiazole.
| Compound Name | 4-hydroxy-5-methyl-3-phenyl-5H-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 601343 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 4-hydroxy-5-methyl-3-phenyl-5H-1,2,4-oxadiazole |
| SMILES | CC1ON=C(c2ccccc2)N1O |
| InChI | InChI=1S/C9H10N2O2/c1-7-11(12)9(10-13-7)8-5-3-2-4-6-8/h2-7,12H,1H3 |
| InChIKey | FBAULXHLBKKEDH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |