C10H11N3O — CID 171384476
N,4-dimethyl-3-phenyl-1,2,4-oxadiazol-5-imine (PubChem CID 171384476) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is N,4-dimethyl-3-phenyl-1,2,4-oxadiazol-5-imine.
| Compound Name | N,4-dimethyl-3-phenyl-1,2,4-oxadiazol-5-imine |
|---|---|
| PubChem CID | 171384476 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | N,4-dimethyl-3-phenyl-1,2,4-oxadiazol-5-imine |
| SMILES | C/N=c1\onc(-c2ccccc2)n1C |
| InChI | InChI=1S/C10H11N3O/c1-11-10-13(2)9(12-14-10)8-6-4-3-5-7-8/h3-7H,1-2H3/b11-10- |
| InChIKey | HLRUSCKHZRZAFB-KHPPLWFESA-N |
| XLogP | 1.21 |
| TPSA | 43.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |