C13H9N7O5 — CID 6019475
5-(imidazole-1-carbonyl)-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1H-imidazole-4-carboxamide (PubChem CID 6019475) has the molecular formula C13H9N7O5 and a molecular weight of 343.26 g/mol. Its IUPAC name is 5-(imidazole-1-carbonyl)-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1H-imidazole-4-carboxamide.
| Compound Name | 5-(imidazole-1-carbonyl)-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 6019475 |
| Molecular Formula | C13H9N7O5 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 5-(imidazole-1-carbonyl)-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1H-imidazole-4-carboxamide |
| SMILES | O=C(N/N=C\c1ccc([N+](=O)[O-])o1)c1nc[nH]c1C(=O)n1ccnc1 |
| InChI | InChI=1S/C13H9N7O5/c21-12(18-17-5-8-1-2-9(25-8)20(23)24)10-11(16-6-15-10)13(22)19-4-3-14-7-19/h1-7H,(H,15,16)(H,18,21)/b17-5- |
| InChIKey | INBUCPKPKHKPNN-ZWSORDCHSA-N |
| XLogP | 0.56 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|