C23H23N3OS — CID 6020261
(E)-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-3-(2,4,6-trimethylphenyl)prop-2-enenitrile (PubChem CID 6020261) has the molecular formula C23H23N3OS and a molecular weight of 389.52 g/mol. Its IUPAC name is (E)-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-3-(2,4,6-trimethylphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-3-(2,4,6-trimethylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6020261 |
| Molecular Formula | C23H23N3OS |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | (E)-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-3-(2,4,6-trimethylphenyl)prop-2-enenitrile |
| SMILES | Cc1cc(C)c(/C=C(\C#N)c2nc3sc4c(c3c(=O)[nH]2)CCC(C)C4)c(C)c1 |
| InChI | InChI=1S/C23H23N3OS/c1-12-5-6-17-19(9-12)28-23-20(17)22(27)25-21(26-23)16(11-24)10-18-14(3)7-13(2)8-15(18)4/h7-8,10,12H,5-6,9H2,1-4H3,(H,25,26,27)/b16-10+ |
| InChIKey | QQASIUWDMKRPIG-MHWRWJLKSA-N |
| XLogP | 5.10 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|