C21H15N5OS — CID 8785054
(E)-2-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-3-quinoxalin-2-ylprop-2-enenitrile (PubChem CID 8785054) has the molecular formula C21H15N5OS and a molecular weight of 385.45 g/mol. Its IUPAC name is (E)-2-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-3-quinoxalin-2-ylprop-2-enenitrile.
| Compound Name | (E)-2-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-3-quinoxalin-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 8785054 |
| Molecular Formula | C21H15N5OS |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | (E)-2-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-3-quinoxalin-2-ylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1cnc2ccccc2n1)c1nc2sc3c(c2c(=O)[nH]1)CCCC3 |
| InChI | InChI=1S/C21H15N5OS/c22-10-12(9-13-11-23-15-6-2-3-7-16(15)24-13)19-25-20(27)18-14-5-1-4-8-17(14)28-21(18)26-19/h2-3,6-7,9,11H,1,4-5,8H2,(H,25,26,27)/b12-9+ |
| InChIKey | ADTXGFGOCWBVJS-FMIVXFBMSA-N |
| XLogP | 3.87 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|