C19H13F2N3OS — CID 7912499
(E)-3-(2,6-difluorophenyl)-2-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)prop-2-enenitrile (PubChem CID 7912499) has the molecular formula C19H13F2N3OS and a molecular weight of 369.40 g/mol. Its IUPAC name is (E)-3-(2,6-difluorophenyl)-2-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(2,6-difluorophenyl)-2-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 7912499 |
| Molecular Formula | C19H13F2N3OS |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | (E)-3-(2,6-difluorophenyl)-2-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1c(F)cccc1F)c1nc2sc3c(c2c(=O)[nH]1)CCCC3 |
| InChI | InChI=1S/C19H13F2N3OS/c20-13-5-3-6-14(21)12(13)8-10(9-22)17-23-18(25)16-11-4-1-2-7-15(11)26-19(16)24-17/h3,5-6,8H,1-2,4,7H2,(H,23,24,25)/b10-8+ |
| InChIKey | VLUFDDPRJVAJEC-CSKARUKUSA-N |
| XLogP | 4.21 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|