About 2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one
2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 602171) has the molecular formula C7H7N3OS
and a molecular weight of 181.22 g/mol. Its IUPAC name is 2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
Analyze 2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one?
The IUPAC name of 2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (CID 602171) is 2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
What is the SMILES notation for 2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one?
The canonical SMILES for 2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one is CCc1nn2ccc(=O)nc2s1.
What is the InChIKey of 2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one?
The InChIKey is OFLCNTMWHRBBHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3OS/c1-2-6-9-10-4-3-5(11)8-7(10)12-6/h3-4H,2H2,1H3.
What are the key properties of 2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one?
2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one has a molecular weight of 181.22 g/mol, XLogP of 0.71, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one is sourced from PubChem (CID 602171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).