C15H10ClN3O2S — CID 56964291
6-chloro-3-(2-ethylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)chromen-2-one (PubChem CID 56964291) has the molecular formula C15H10ClN3O2S and a molecular weight of 331.78 g/mol. Its IUPAC name is 6-chloro-3-(2-ethylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)chromen-2-one.
| Compound Name | 6-chloro-3-(2-ethylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)chromen-2-one |
|---|---|
| PubChem CID | 56964291 |
| Molecular Formula | C15H10ClN3O2S |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 6-chloro-3-(2-ethylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)chromen-2-one |
| SMILES | CCc1nn2cc(-c3cc4cc(Cl)ccc4oc3=O)nc2s1 |
| InChI | InChI=1S/C15H10ClN3O2S/c1-2-13-18-19-7-11(17-15(19)22-13)10-6-8-5-9(16)3-4-12(8)21-14(10)20/h3-7H,2H2,1H3 |
| InChIKey | MTSMMPCDTGUXEU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 60.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|