C16H17BrClNO3S2 — CID 6022425
(NZ)-N-[(2-bromophenyl)-(2-chloro-1-ethoxyethyl)-λ4-sulfanylidene]benzenesulfonamide (PubChem CID 6022425) has the molecular formula C16H17BrClNO3S2 and a molecular weight of 450.81 g/mol. Its IUPAC name is (NZ)-N-[(2-bromophenyl)-(2-chloro-1-ethoxyethyl)-λ4-sulfanylidene]benzenesulfonamide.
| Compound Name | (NZ)-N-[(2-bromophenyl)-(2-chloro-1-ethoxyethyl)-λ4-sulfanylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 6022425 |
| Molecular Formula | C16H17BrClNO3S2 |
| Molecular Weight | 450.81 g/mol |
| Exact Mass | 448.95 |
| IUPAC Name | (NZ)-N-[(2-bromophenyl)-(2-chloro-1-ethoxyethyl)-λ4-sulfanylidene]benzenesulfonamide |
| SMILES | CCOC(CCl)/S(=N\S(=O)(=O)c1ccccc1)c1ccccc1Br |
| InChI | InChI=1S/C16H17BrClNO3S2/c1-2-22-16(12-18)23(15-11-7-6-10-14(15)17)19-24(20,21)13-8-4-3-5-9-13/h3-11,16H,2,12H2,1H3 |
| InChIKey | GZLMKSUBVPSCTB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.81 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|