C16H17ClN2O5S2 — CID 2368695
N-[[(1S)-2-chloro-1-ethoxyethyl]-(2-nitrophenyl)-lambda4-sulfanylidene]benzenesulfonamide (PubChem CID 2368695) has the molecular formula C16H17ClN2O5S2 and a molecular weight of 416.91 g/mol. Its IUPAC name is N-[[(1S)-2-chloro-1-ethoxyethyl]-(2-nitrophenyl)-lambda4-sulfanylidene]benzenesulfonamide.
| Compound Name | N-[[(1S)-2-chloro-1-ethoxyethyl]-(2-nitrophenyl)-lambda4-sulfanylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 2368695 |
| Molecular Formula | C16H17ClN2O5S2 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | N-[[(1S)-2-chloro-1-ethoxyethyl]-(2-nitrophenyl)-lambda4-sulfanylidene]benzenesulfonamide |
| SMILES | CCO[C@H](CCl)S(=NS(=O)(=O)c1ccccc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17ClN2O5S2/c1-2-24-16(12-17)25(15-11-7-6-10-14(15)19(20)21)18-26(22,23)13-8-4-3-5-9-13/h3-11,16H,2,12H2,1H3/t16-,25?/m0/s1 |
| InChIKey | VZNPANMIWISKSX-YPHZTSLFSA-N |
| XLogP | 3.75 |
| TPSA | 98.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|