C16H18N4O6S2 — CID 10048108
(NZ)-N-[diethylamino-(2,4-dinitrophenyl)-λ4-sulfanylidene]benzenesulfonamide (PubChem CID 10048108) has the molecular formula C16H18N4O6S2 and a molecular weight of 426.48 g/mol. Its IUPAC name is (NZ)-N-[diethylamino-(2,4-dinitrophenyl)-λ4-sulfanylidene]benzenesulfonamide.
| Compound Name | (NZ)-N-[diethylamino-(2,4-dinitrophenyl)-λ4-sulfanylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 10048108 |
| Molecular Formula | C16H18N4O6S2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | (NZ)-N-[diethylamino-(2,4-dinitrophenyl)-λ4-sulfanylidene]benzenesulfonamide |
| SMILES | CCN(CC)/S(=N\S(=O)(=O)c1ccccc1)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N4O6S2/c1-3-18(4-2)27(17-28(25,26)14-8-6-5-7-9-14)16-11-10-13(19(21)22)12-15(16)20(23)24/h5-12H,3-4H2,1-2H3 |
| InChIKey | ZBVWQQIMSHFTMN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 136.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|