C15H16BrN3O4 — CID 6024173
N-[(Z)-(2-bromo-5-ethoxyphenyl)methylideneamino]-5-ethoxy-1,3-oxazole-2-carboxamide (PubChem CID 6024173) has the molecular formula C15H16BrN3O4 and a molecular weight of 382.21 g/mol. Its IUPAC name is N-[(Z)-(2-bromo-5-ethoxyphenyl)methylideneamino]-5-ethoxy-1,3-oxazole-2-carboxamide.
| Compound Name | N-[(Z)-(2-bromo-5-ethoxyphenyl)methylideneamino]-5-ethoxy-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 6024173 |
| Molecular Formula | C15H16BrN3O4 |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | N-[(Z)-(2-bromo-5-ethoxyphenyl)methylideneamino]-5-ethoxy-1,3-oxazole-2-carboxamide |
| SMILES | CCOc1ccc(Br)c(/C=N\NC(=O)c2ncc(OCC)o2)c1 |
| InChI | InChI=1S/C15H16BrN3O4/c1-3-21-11-5-6-12(16)10(7-11)8-18-19-14(20)15-17-9-13(23-15)22-4-2/h5-9H,3-4H2,1-2H3,(H,19,20)/b18-8- |
| InChIKey | QWQOIHFJQKPGHV-LSCVHKIXSA-N |
| XLogP | 3.00 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|