C25H21N3O2S — CID 6029328
2-[1-[(Z)-(4-methoxyphenyl)methylideneamino]-4-phenylimidazol-2-yl]sulfanyl-1-phenylethanone (PubChem CID 6029328) has the molecular formula C25H21N3O2S and a molecular weight of 427.53 g/mol. Its IUPAC name is 2-[1-[(Z)-(4-methoxyphenyl)methylideneamino]-4-phenylimidazol-2-yl]sulfanyl-1-phenylethanone.
| Compound Name | 2-[1-[(Z)-(4-methoxyphenyl)methylideneamino]-4-phenylimidazol-2-yl]sulfanyl-1-phenylethanone |
|---|---|
| PubChem CID | 6029328 |
| Molecular Formula | C25H21N3O2S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 2-[1-[(Z)-(4-methoxyphenyl)methylideneamino]-4-phenylimidazol-2-yl]sulfanyl-1-phenylethanone |
| SMILES | COc1ccc(/C=N\n2cc(-c3ccccc3)nc2SCC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21N3O2S/c1-30-22-14-12-19(13-15-22)16-26-28-17-23(20-8-4-2-5-9-20)27-25(28)31-18-24(29)21-10-6-3-7-11-21/h2-17H,18H2,1H3/b26-16- |
| InChIKey | XCHLBJBOPATIPE-QQXSKIMKSA-N |
| XLogP | 5.42 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|