About 2-bromoethyl (E)-3-azidoprop-2-enoate
2-bromoethyl (E)-3-azidoprop-2-enoate (PubChem CID 6039555) has the molecular formula C5H6BrN3O2
and a molecular weight of 220.03 g/mol. Its IUPAC name is 2-bromoethyl (E)-3-azidoprop-2-enoate.
Molecular Properties
| Compound Name | 2-bromoethyl (E)-3-azidoprop-2-enoate |
| PubChem CID | 6039555 |
| Molecular Formula | C5H6BrN3O2 |
| Molecular Weight | 220.03 g/mol |
| Exact Mass | 218.96 |
| IUPAC Name | 2-bromoethyl (E)-3-azidoprop-2-enoate |
| SMILES | [N-]=[N+]=N/C=C/C(=O)OCCBr |
| InChI | InChI=1S/C5H6BrN3O2/c6-2-4-11-5(10)1-3-8-9-7/h1,3H,2,4H2/b3-1+ |
| InChIKey | AKIYUJWNPUDUAA-HNQUOIGGSA-N |
| XLogP | 1.75 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.03 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoethyl (E)-3-azidoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoethyl (E)-3-azidoprop-2-enoate?
The IUPAC name of 2-bromoethyl (E)-3-azidoprop-2-enoate (CID 6039555) is 2-bromoethyl (E)-3-azidoprop-2-enoate.
What is the SMILES notation for 2-bromoethyl (E)-3-azidoprop-2-enoate?
The canonical SMILES for 2-bromoethyl (E)-3-azidoprop-2-enoate is [N-]=[N+]=N/C=C/C(=O)OCCBr.
What is the InChIKey of 2-bromoethyl (E)-3-azidoprop-2-enoate?
The InChIKey is AKIYUJWNPUDUAA-HNQUOIGGSA-N. The full InChI is InChI=1S/C5H6BrN3O2/c6-2-4-11-5(10)1-3-8-9-7/h1,3H,2,4H2/b3-1+.
What are the key properties of 2-bromoethyl (E)-3-azidoprop-2-enoate?
2-bromoethyl (E)-3-azidoprop-2-enoate has a molecular weight of 220.03 g/mol, XLogP of 1.75, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoethyl (E)-3-azidoprop-2-enoate is sourced from PubChem (CID 6039555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).